About [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid
[3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid (PubChem CID 150174880) has the molecular formula C10H15NO4S
and a molecular weight of 245.30 g/mol. Its IUPAC name is [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid.
Molecular Properties
| Compound Name | [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid |
| PubChem CID | 150174880 |
| Molecular Formula | C10H15NO4S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid |
| SMILES | COCc1c(C)ccc(NS(=O)(=O)O)c1C |
| InChI | InChI=1S/C10H15NO4S/c1-7-4-5-10(11-16(12,13)14)8(2)9(7)6-15-3/h4-5,11H,6H2,1-3H3,(H,12,13,14) |
| InChIKey | FKEXNXRKNVMGLS-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid?
The IUPAC name of [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid (CID 150174880) is [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid.
What is the SMILES notation for [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid?
The canonical SMILES for [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid is COCc1c(C)ccc(NS(=O)(=O)O)c1C.
What is the InChIKey of [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid?
The InChIKey is FKEXNXRKNVMGLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4S/c1-7-4-5-10(11-16(12,13)14)8(2)9(7)6-15-3/h4-5,11H,6H2,1-3H3,(H,12,13,14).
What are the key properties of [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid?
[3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid has a molecular weight of 245.30 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(methoxymethyl)-2,4-dimethylphenyl]sulfamic acid is sourced from PubChem (CID 150174880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).