C9H4F6O5S — CID 15017664
methyl 2,4,5-trifluoro-3-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 15017664) has the molecular formula C9H4F6O5S and a molecular weight of 338.18 g/mol. Its IUPAC name is methyl 2,4,5-trifluoro-3-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | methyl 2,4,5-trifluoro-3-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 15017664 |
| Molecular Formula | C9H4F6O5S |
| Molecular Weight | 338.18 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | methyl 2,4,5-trifluoro-3-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1cc(F)c(F)c(OS(=O)(=O)C(F)(F)F)c1F |
| InChI | InChI=1S/C9H4F6O5S/c1-19-8(16)3-2-4(10)6(12)7(5(3)11)20-21(17,18)9(13,14)15/h2H,1H3 |
| InChIKey | UBPKALCFOJTAGB-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|