About [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate
[2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate (PubChem CID 150180162) has the molecular formula C24H19ClF2N2O4
and a molecular weight of 472.88 g/mol. Its IUPAC name is [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate.
Molecular Properties
| Compound Name | [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate |
| PubChem CID | 150180162 |
| Molecular Formula | C24H19ClF2N2O4 |
| Molecular Weight | 472.88 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate |
| SMILES | CC(c1ccc(OCC(F)F)c(Cl)c1)N1Cc2ccc(OC(=O)c3ccncc3)cc2C1=O |
| InChI | InChI=1S/C24H19ClF2N2O4/c1-14(16-3-5-21(20(25)10-16)32-13-22(26)27)29-12-17-2-4-18(11-19(17)23(29)30)33-24(31)15-6-8-28-9-7-15/h2-11,14,22H,12-13H2,1H3 |
| InChIKey | FLGAVCYJMHYZDZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.88 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate?
The IUPAC name of [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate (CID 150180162) is [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate.
What is the SMILES notation for [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate?
The canonical SMILES for [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate is CC(c1ccc(OCC(F)F)c(Cl)c1)N1Cc2ccc(OC(=O)c3ccncc3)cc2C1=O.
What is the InChIKey of [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate?
The InChIKey is FLGAVCYJMHYZDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19ClF2N2O4/c1-14(16-3-5-21(20(25)10-16)32-13-22(26)27)29-12-17-2-4-18(11-19(17)23(29)30)33-24(31)15-6-8-28-9-7-15/h2-11,14,22H,12-13H2,1H3.
What are the key properties of [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate?
[2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate has a molecular weight of 472.88 g/mol, XLogP of 5.32, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-3-oxo-1H-isoindol-5-yl] pyridine-4-carboxylate is sourced from PubChem (CID 150180162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).