C10H12F9I — CID 150181164
4-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)heptane (PubChem CID 150181164) has the molecular formula C10H12F9I and a molecular weight of 430.09 g/mol. Its IUPAC name is 4-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)heptane.
| Compound Name | 4-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)heptane |
|---|---|
| PubChem CID | 150181164 |
| Molecular Formula | C10H12F9I |
| Molecular Weight | 430.09 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 4-ethyl-1,1,1,2,2,3-hexafluoro-5-iodo-3-(trifluoromethyl)heptane |
| SMILES | CCC(I)C(CC)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F9I/c1-3-5(6(20)4-2)7(11,9(14,15)16)8(12,13)10(17,18)19/h5-6H,3-4H2,1-2H3 |
| InChIKey | FLLPYYWQWASRFO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.09 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|