C22H29N3O3 — CID 15018148
ethyl 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)carbamoyl]amino]-3-phenylbutanoate (PubChem CID 15018148) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)carbamoyl]amino]-3-phenylbutanoate.
| Compound Name | ethyl 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)carbamoyl]amino]-3-phenylbutanoate |
|---|---|
| PubChem CID | 15018148 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 3-methyl-2-[[methyl(2-pyridin-2-ylethyl)carbamoyl]amino]-3-phenylbutanoate |
| SMILES | CCOC(=O)C(NC(=O)N(C)CCc1ccccn1)C(C)(C)c1ccccc1 |
| InChI | InChI=1S/C22H29N3O3/c1-5-28-20(26)19(22(2,3)17-11-7-6-8-12-17)24-21(27)25(4)16-14-18-13-9-10-15-23-18/h6-13,15,19H,5,14,16H2,1-4H3,(H,24,27) |
| InChIKey | XIWCVXWXRAUWBH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |