About 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene
7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene (PubChem CID 150184900) has the molecular formula C20H22O
and a molecular weight of 278.39 g/mol. Its IUPAC name is 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene |
| PubChem CID | 150184900 |
| Molecular Formula | C20H22O |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene |
| SMILES | CC(C)(C)Oc1ccc2c(c1)CCC(c1ccccc1)=C2 |
| InChI | InChI=1S/C20H22O/c1-20(2,3)21-19-12-11-17-13-16(9-10-18(17)14-19)15-7-5-4-6-8-15/h4-8,11-14H,9-10H2,1-3H3 |
| InChIKey | FMEYAGLCAOTDHW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene?
The IUPAC name of 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene (CID 150184900) is 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene.
What is the SMILES notation for 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene?
The canonical SMILES for 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene is CC(C)(C)Oc1ccc2c(c1)CCC(c1ccccc1)=C2.
What is the InChIKey of 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene?
The InChIKey is FMEYAGLCAOTDHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O/c1-20(2,3)21-19-12-11-17-13-16(9-10-18(17)14-19)15-7-5-4-6-8-15/h4-8,11-14H,9-10H2,1-3H3.
What are the key properties of 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene?
7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene has a molecular weight of 278.39 g/mol, XLogP of 5.35, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(2-methylpropan-2-yl)oxy]-3-phenyl-1,2-dihydronaphthalene is sourced from PubChem (CID 150184900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).