About (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene
(6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene (PubChem CID 150186425) has the molecular formula C22H43O3P
and a molecular weight of 386.56 g/mol. Its IUPAC name is (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene.
Molecular Properties
| Compound Name | (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene |
| PubChem CID | 150186425 |
| Molecular Formula | C22H43O3P |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCP(=O)(OCC)OCC |
| InChI | InChI=1S/C22H43O3P/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(23,24-5-2)25-6-3/h10-11,13-14H,4-9,12,15-22H2,1-3H3/b11-10-,14-13- |
| InChIKey | FMNIDGJPHCPSOZ-XVTLYKPTSA-N |
| XLogP | 8.07 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene?
The IUPAC name of (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene (CID 150186425) is (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene.
What is the SMILES notation for (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene?
The canonical SMILES for (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene is CCCCC/C=C\C/C=C\CCCCCCCCP(=O)(OCC)OCC.
What is the InChIKey of (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene?
The InChIKey is FMNIDGJPHCPSOZ-XVTLYKPTSA-N. The full InChI is InChI=1S/C22H43O3P/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26(23,24-5-2)25-6-3/h10-11,13-14H,4-9,12,15-22H2,1-3H3/b11-10-,14-13-.
What are the key properties of (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene?
(6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene has a molecular weight of 386.56 g/mol, XLogP of 8.07, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z,9Z)-18-diethoxyphosphoryloctadeca-6,9-diene is sourced from PubChem (CID 150186425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).