About [2-(trifluoromethyl)phenyl] 2-propylheptanoate
[2-(trifluoromethyl)phenyl] 2-propylheptanoate (PubChem CID 150187498) has the molecular formula C17H23F3O2
and a molecular weight of 316.36 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl] 2-propylheptanoate.
Molecular Properties
| Compound Name | [2-(trifluoromethyl)phenyl] 2-propylheptanoate |
| PubChem CID | 150187498 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [2-(trifluoromethyl)phenyl] 2-propylheptanoate |
| SMILES | CCCCCC(CCC)C(=O)Oc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H23F3O2/c1-3-5-6-10-13(9-4-2)16(21)22-15-12-8-7-11-14(15)17(18,19)20/h7-8,11-13H,3-6,9-10H2,1-2H3 |
| InChIKey | FMSROHHZXBHSJG-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(trifluoromethyl)phenyl] 2-propylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(trifluoromethyl)phenyl] 2-propylheptanoate?
The IUPAC name of [2-(trifluoromethyl)phenyl] 2-propylheptanoate (CID 150187498) is [2-(trifluoromethyl)phenyl] 2-propylheptanoate.
What is the SMILES notation for [2-(trifluoromethyl)phenyl] 2-propylheptanoate?
The canonical SMILES for [2-(trifluoromethyl)phenyl] 2-propylheptanoate is CCCCCC(CCC)C(=O)Oc1ccccc1C(F)(F)F.
What is the InChIKey of [2-(trifluoromethyl)phenyl] 2-propylheptanoate?
The InChIKey is FMSROHHZXBHSJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F3O2/c1-3-5-6-10-13(9-4-2)16(21)22-15-12-8-7-11-14(15)17(18,19)20/h7-8,11-13H,3-6,9-10H2,1-2H3.
What are the key properties of [2-(trifluoromethyl)phenyl] 2-propylheptanoate?
[2-(trifluoromethyl)phenyl] 2-propylheptanoate has a molecular weight of 316.36 g/mol, XLogP of 5.61, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(trifluoromethyl)phenyl] 2-propylheptanoate is sourced from PubChem (CID 150187498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).