C11H13NO4 — CID 150187772
7,9-dimethoxy-1-azaspiro[4.5]deca-6,9-diene-2,8-dione (PubChem CID 150187772) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is 7,9-dimethoxy-1-azaspiro[4.5]deca-6,9-diene-2,8-dione.
| Compound Name | 7,9-dimethoxy-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
|---|---|
| PubChem CID | 150187772 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 7,9-dimethoxy-1-azaspiro[4.5]deca-6,9-diene-2,8-dione |
| SMILES | COC1=CC2(C=C(OC)C1=O)CCC(=O)N2 |
| InChI | InChI=1S/C11H13NO4/c1-15-7-5-11(4-3-9(13)12-11)6-8(16-2)10(7)14/h5-6H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | FMUDRWSZSZDXDZ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |