C28H28BClF2N4O3 — CID 150188317
2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine (PubChem CID 150188317) has the molecular formula C28H28BClF2N4O3 and a molecular weight of 552.82 g/mol. Its IUPAC name is 2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine.
| Compound Name | 2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine |
|---|---|
| PubChem CID | 150188317 |
| Molecular Formula | C28H28BClF2N4O3 |
| Molecular Weight | 552.82 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 2-[3-(5-chloro-2,4-difluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,5-naphthyridine |
| SMILES | CC1(C)OB(c2cnc3ccc(-c4cn(C5CCCCO5)nc4-c4cc(Cl)c(F)cc4F)nc3c2)OC1(C)C |
| InChI | InChI=1S/C28H28BClF2N4O3/c1-27(2)28(3,4)39-29(38-27)16-11-24-23(33-14-16)9-8-22(34-24)18-15-36(25-7-5-6-10-37-25)35-26(18)17-12-19(30)21(32)13-20(17)31/h8-9,11-15,25H,5-7,10H2,1-4H3 |
| InChIKey | FMXDTXSLUYATKG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.82 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|