About 1,2,7-tribromonaphthalene
1,2,7-tribromonaphthalene (PubChem CID 150191333) has the molecular formula C10H5Br3
and a molecular weight of 364.86 g/mol. Its IUPAC name is 1,2,7-tribromonaphthalene.
Molecular Properties
| Compound Name | 1,2,7-tribromonaphthalene |
| PubChem CID | 150191333 |
| Molecular Formula | C10H5Br3 |
| Molecular Weight | 364.86 g/mol |
| Exact Mass | 361.79 |
| IUPAC Name | 1,2,7-tribromonaphthalene |
| SMILES | Brc1ccc2ccc(Br)c(Br)c2c1 |
| InChI | InChI=1S/C10H5Br3/c11-7-3-1-6-2-4-9(12)10(13)8(6)5-7/h1-5H |
| InChIKey | FNMRJGDUAPHHKU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.86 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2,7-tribromonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,7-tribromonaphthalene?
The IUPAC name of 1,2,7-tribromonaphthalene (CID 150191333) is 1,2,7-tribromonaphthalene.
What is the SMILES notation for 1,2,7-tribromonaphthalene?
The canonical SMILES for 1,2,7-tribromonaphthalene is Brc1ccc2ccc(Br)c(Br)c2c1.
What is the InChIKey of 1,2,7-tribromonaphthalene?
The InChIKey is FNMRJGDUAPHHKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Br3/c11-7-3-1-6-2-4-9(12)10(13)8(6)5-7/h1-5H.
What are the key properties of 1,2,7-tribromonaphthalene?
1,2,7-tribromonaphthalene has a molecular weight of 364.86 g/mol, XLogP of 5.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,7-tribromonaphthalene is sourced from PubChem (CID 150191333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).