C11H8N4 — CID 150191533
2-(1,2,4-triazin-3-yl)-1H-indole (PubChem CID 150191533) has the molecular formula C11H8N4 and a molecular weight of 196.21 g/mol. Its IUPAC name is 2-(1,2,4-triazin-3-yl)-1H-indole.
| Compound Name | 2-(1,2,4-triazin-3-yl)-1H-indole |
|---|---|
| PubChem CID | 150191533 |
| Molecular Formula | C11H8N4 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 2-(1,2,4-triazin-3-yl)-1H-indole |
| SMILES | c1ccc2[nH]c(-c3nccnn3)cc2c1 |
| InChI | InChI=1S/C11H8N4/c1-2-4-9-8(3-1)7-10(14-9)11-12-5-6-13-15-11/h1-7,14H |
| InChIKey | FNNWJLPHSLNQNC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |