C17H9F17S — CID 150192117
1-ethenyl-3-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-2-ylsulfanylmethyl)benzene (PubChem CID 150192117) has the molecular formula C17H9F17S and a molecular weight of 568.29 g/mol. Its IUPAC name is 1-ethenyl-3-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-2-ylsulfanylmethyl)benzene.
| Compound Name | 1-ethenyl-3-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-2-ylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 150192117 |
| Molecular Formula | C17H9F17S |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 568.02 |
| IUPAC Name | 1-ethenyl-3-(1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctan-2-ylsulfanylmethyl)benzene |
| SMILES | C=Cc1cccc(CSC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H9F17S/c1-2-8-4-3-5-9(6-8)7-35-15(28,17(32,33)34)13(24,25)11(20,21)10(18,19)12(22,23)14(26,27)16(29,30)31/h2-6H,1,7H2 |
| InChIKey | FNQWTXXYHSOEKI-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|