C35H28F7O4P — CID 15019347
ethyl 2-[(E)-3,3,4,4,5,5,5-heptafluoro-2-[2-methoxy-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]pent-1-enyl]benzoate (PubChem CID 15019347) has the molecular formula C35H28F7O4P and a molecular weight of 676.57 g/mol. Its IUPAC name is ethyl 2-[(E)-3,3,4,4,5,5,5-heptafluoro-2-[2-methoxy-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]pent-1-enyl]benzoate.
| Compound Name | ethyl 2-[(E)-3,3,4,4,5,5,5-heptafluoro-2-[2-methoxy-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]pent-1-enyl]benzoate |
|---|---|
| PubChem CID | 15019347 |
| Molecular Formula | C35H28F7O4P |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 676.16 |
| IUPAC Name | ethyl 2-[(E)-3,3,4,4,5,5,5-heptafluoro-2-[2-methoxy-2-oxo-1-(triphenyl-lambda5-phosphanylidene)ethyl]pent-1-enyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1/C=C(/C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H28F7O4P/c1-3-46-31(43)28-22-14-13-15-24(28)23-29(33(36,37)34(38,39)35(40,41)42)30(32(44)45-2)47(25-16-7-4-8-17-25,26-18-9-5-10-19-26)27-20-11-6-12-21-27/h4-23H,3H2,1-2H3/b29-23- |
| InChIKey | OKQQSJKFSFGEGC-FAJYDZGRSA-N |
| XLogP | 7.42 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|