About 4,5-diethoxyhex-4-en-2-one
4,5-diethoxyhex-4-en-2-one (PubChem CID 150194867) has the molecular formula C10H18O3
and a molecular weight of 186.25 g/mol. Its IUPAC name is 4,5-diethoxyhex-4-en-2-one.
Molecular Properties
| Compound Name | 4,5-diethoxyhex-4-en-2-one |
| PubChem CID | 150194867 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | 4,5-diethoxyhex-4-en-2-one |
| SMILES | CCOC(C)=C(CC(C)=O)OCC |
| InChI | InChI=1S/C10H18O3/c1-5-12-9(4)10(13-6-2)7-8(3)11/h5-7H2,1-4H3 |
| InChIKey | FOFPXYVLYOMIHJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4,5-diethoxyhex-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diethoxyhex-4-en-2-one?
The IUPAC name of 4,5-diethoxyhex-4-en-2-one (CID 150194867) is 4,5-diethoxyhex-4-en-2-one.
What is the SMILES notation for 4,5-diethoxyhex-4-en-2-one?
The canonical SMILES for 4,5-diethoxyhex-4-en-2-one is CCOC(C)=C(CC(C)=O)OCC.
What is the InChIKey of 4,5-diethoxyhex-4-en-2-one?
The InChIKey is FOFPXYVLYOMIHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3/c1-5-12-9(4)10(13-6-2)7-8(3)11/h5-7H2,1-4H3.
What are the key properties of 4,5-diethoxyhex-4-en-2-one?
4,5-diethoxyhex-4-en-2-one has a molecular weight of 186.25 g/mol, XLogP of 2.27, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diethoxyhex-4-en-2-one is sourced from PubChem (CID 150194867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).