C26H41NO2 — CID 150195198
N-(1-hydroxy-2-methylheptyl)octadeca-2,4,6,10,12,14-hexaenamide (PubChem CID 150195198) has the molecular formula C26H41NO2 and a molecular weight of 399.62 g/mol. Its IUPAC name is N-(1-hydroxy-2-methylheptyl)octadeca-2,4,6,10,12,14-hexaenamide.
| Compound Name | N-(1-hydroxy-2-methylheptyl)octadeca-2,4,6,10,12,14-hexaenamide |
|---|---|
| PubChem CID | 150195198 |
| Molecular Formula | C26H41NO2 |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.31 |
| IUPAC Name | N-(1-hydroxy-2-methylheptyl)octadeca-2,4,6,10,12,14-hexaenamide |
| SMILES | CCCC=CC=CC=CCCC=CC=CC=CC(=O)NC(O)C(C)CCCCC |
| InChI | InChI=1S/C26H41NO2/c1-4-6-8-9-10-11-12-13-14-15-16-17-18-19-21-23-25(28)27-26(29)24(3)22-20-7-5-2/h8-13,16-19,21,23-24,26,29H,4-7,14-15,20,22H2,1-3H3,(H,27,28) |
| InChIKey | FOHMJKBGFHJBNT-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|