C19H15N3O2 — CID 15019902
4-methyl-2,7-diphenyl-5H-pyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 15019902) has the molecular formula C19H15N3O2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 4-methyl-2,7-diphenyl-5H-pyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | 4-methyl-2,7-diphenyl-5H-pyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 15019902 |
| Molecular Formula | C19H15N3O2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 4-methyl-2,7-diphenyl-5H-pyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | CC1=C2C(=O)N(c3ccccc3)N=C2N(c2ccccc2)C(=O)C1 |
| InChI | InChI=1S/C19H15N3O2/c1-13-12-16(23)21(14-8-4-2-5-9-14)18-17(13)19(24)22(20-18)15-10-6-3-7-11-15/h2-11H,12H2,1H3 |
| InChIKey | AILNYUFPXONHHJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'} |
|---|