C21H25Cl3N2O — CID 15020210
1-(4-octylphenyl)-3-(2,4,6-trichlorophenyl)urea (PubChem CID 15020210) has the molecular formula C21H25Cl3N2O and a molecular weight of 427.80 g/mol. Its IUPAC name is 1-(4-octylphenyl)-3-(2,4,6-trichlorophenyl)urea.
| Compound Name | 1-(4-octylphenyl)-3-(2,4,6-trichlorophenyl)urea |
|---|---|
| PubChem CID | 15020210 |
| Molecular Formula | C21H25Cl3N2O |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 1-(4-octylphenyl)-3-(2,4,6-trichlorophenyl)urea |
| SMILES | CCCCCCCCc1ccc(NC(=O)Nc2c(Cl)cc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H25Cl3N2O/c1-2-3-4-5-6-7-8-15-9-11-17(12-10-15)25-21(27)26-20-18(23)13-16(22)14-19(20)24/h9-14H,2-8H2,1H3,(H2,25,26,27) |
| InChIKey | BIKHEQIPAMIQDS-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|