C23H21N5O3 — CID 150203316
4-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-nitro-1H-1,5-naphthyridin-2-one (PubChem CID 150203316) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is 4-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-nitro-1H-1,5-naphthyridin-2-one.
| Compound Name | 4-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-nitro-1H-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 150203316 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-[4-(naphthalen-1-ylmethyl)piperazin-1-yl]-3-nitro-1H-1,5-naphthyridin-2-one |
| SMILES | O=c1[nH]c2cccnc2c(N2CCN(Cc3cccc4ccccc34)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H21N5O3/c29-23-22(28(30)31)21(20-19(25-23)9-4-10-24-20)27-13-11-26(12-14-27)15-17-7-3-6-16-5-1-2-8-18(16)17/h1-10H,11-15H2,(H,25,29) |
| InChIKey | FPYHHAGZALBIPD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|