About 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one
2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one (PubChem CID 150203652) has the molecular formula C23H38N4O3
and a molecular weight of 418.58 g/mol. Its IUPAC name is 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one.
Molecular Properties
| Compound Name | 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one |
| PubChem CID | 150203652 |
| Molecular Formula | C23H38N4O3 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)N1CC=C(N2CCOCC2)CC1)N1CC=C(N2CCOCC2)CC1 |
| InChI | InChI=1S/C23H38N4O3/c1-19(24-7-3-21(4-8-24)26-11-15-29-16-12-26)23(28)20(2)25-9-5-22(6-10-25)27-13-17-30-18-14-27/h3,5,19-20H,4,6-18H2,1-2H3 |
| InChIKey | FQADYJKKDVUVDE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one?
The IUPAC name of 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one (CID 150203652) is 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one.
What is the SMILES notation for 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one?
The canonical SMILES for 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one is CC(C(=O)C(C)N1CC=C(N2CCOCC2)CC1)N1CC=C(N2CCOCC2)CC1.
What is the InChIKey of 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one?
The InChIKey is FQADYJKKDVUVDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38N4O3/c1-19(24-7-3-21(4-8-24)26-11-15-29-16-12-26)23(28)20(2)25-9-5-22(6-10-25)27-13-17-30-18-14-27/h3,5,19-20H,4,6-18H2,1-2H3.
What are the key properties of 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one?
2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one has a molecular weight of 418.58 g/mol, XLogP of 1.18, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4-morpholin-4-yl-3,6-dihydro-2H-pyridin-1-yl)pentan-3-one is sourced from PubChem (CID 150203652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).