C10H16N2O — CID 15020430
2,5-dihydropyrrol-1-yl-[(2S)-piperidin-2-yl]methanone (PubChem CID 15020430) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2,5-dihydropyrrol-1-yl-[(2S)-piperidin-2-yl]methanone.
| Compound Name | 2,5-dihydropyrrol-1-yl-[(2S)-piperidin-2-yl]methanone |
|---|---|
| PubChem CID | 15020430 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2,5-dihydropyrrol-1-yl-[(2S)-piperidin-2-yl]methanone |
| SMILES | O=C([C@@H]1CCCCN1)N1CC=CC1 |
| InChI | InChI=1S/C10H16N2O/c13-10(12-7-3-4-8-12)9-5-1-2-6-11-9/h3-4,9,11H,1-2,5-8H2/t9-/m0/s1 |
| InChIKey | CLNJGDOGWBBKTL-VIFPVBQESA-N |
| XLogP | 0.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|