About (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine
(2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine (PubChem CID 15020431) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine |
| PubChem CID | 15020431 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine |
| SMILES | C1=CCN(C[C@@H]2CCCCN2)C1 |
| InChI | InChI=1S/C10H18N2/c1-2-6-11-10(5-1)9-12-7-3-4-8-12/h3-4,10-11H,1-2,5-9H2/t10-/m0/s1 |
| InChIKey | WBANQUMKGGWGBX-JTQLQIEISA-N |
| XLogP | 1.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine?
The IUPAC name of (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine (CID 15020431) is (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine.
What is the SMILES notation for (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine?
The canonical SMILES for (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine is C1=CCN(C[C@@H]2CCCCN2)C1.
What is the InChIKey of (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine?
The InChIKey is WBANQUMKGGWGBX-JTQLQIEISA-N. The full InChI is InChI=1S/C10H18N2/c1-2-6-11-10(5-1)9-12-7-3-4-8-12/h3-4,10-11H,1-2,5-9H2/t10-/m0/s1.
What are the key properties of (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine?
(2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine has a molecular weight of 166.27 g/mol, XLogP of 1.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2,5-dihydropyrrol-1-ylmethyl)piperidine is sourced from PubChem (CID 15020431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).