About [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene
[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene (PubChem CID 15020491) has the molecular formula C29H28N4O3
and a molecular weight of 480.57 g/mol. Its IUPAC name is [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene.
Molecular Properties
| Compound Name | [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene |
| PubChem CID | 15020491 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene |
| SMILES | CC1(C)OCC(COc2ccc(/N=N/C(c3ccccc3)(c3ccccc3)c3ccccc3)nn2)O1 |
| InChI | InChI=1S/C29H28N4O3/c1-28(2)35-21-25(36-28)20-34-27-19-18-26(30-32-27)31-33-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,25H,20-21H2,1-2H3/b33-31+ |
| InChIKey | GOWDINWRMWNKDL-QOSDPKFLSA-N |
| XLogP | 6.08 |
| TPSA | 78.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene?
The IUPAC name of [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene (CID 15020491) is [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene.
What is the SMILES notation for [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene?
The canonical SMILES for [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene is CC1(C)OCC(COc2ccc(/N=N/C(c3ccccc3)(c3ccccc3)c3ccccc3)nn2)O1.
What is the InChIKey of [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene?
The InChIKey is GOWDINWRMWNKDL-QOSDPKFLSA-N. The full InChI is InChI=1S/C29H28N4O3/c1-28(2)35-21-25(36-28)20-34-27-19-18-26(30-32-27)31-33-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,25H,20-21H2,1-2H3/b33-31+.
What are the key properties of [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene?
[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene has a molecular weight of 480.57 g/mol, XLogP of 6.08, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-trityldiazene is sourced from PubChem (CID 15020491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).