C29H30N4O3 — CID 15020493
1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-2-tritylhydrazine (PubChem CID 15020493) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-2-tritylhydrazine.
| Compound Name | 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-2-tritylhydrazine |
|---|---|
| PubChem CID | 15020493 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 1-[6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]pyridazin-3-yl]-2-tritylhydrazine |
| SMILES | CC1(C)OCC(COc2ccc(NNC(c3ccccc3)(c3ccccc3)c3ccccc3)nn2)O1 |
| InChI | InChI=1S/C29H30N4O3/c1-28(2)35-21-25(36-28)20-34-27-19-18-26(30-32-27)31-33-29(22-12-6-3-7-13-22,23-14-8-4-9-15-23)24-16-10-5-11-17-24/h3-19,25,33H,20-21H2,1-2H3,(H,30,31) |
| InChIKey | QOQWSZLAYNGPGQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|