C26H33NO2 — CID 150206366
(8R,9S,10R,13R,14S)-10,13-dimethyl-3-oxo-15-phenyl-2,6,7,8,9,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthrene-15-carboxamide (PubChem CID 150206366) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (8R,9S,10R,13R,14S)-10,13-dimethyl-3-oxo-15-phenyl-2,6,7,8,9,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthrene-15-carboxamide.
| Compound Name | (8R,9S,10R,13R,14S)-10,13-dimethyl-3-oxo-15-phenyl-2,6,7,8,9,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthrene-15-carboxamide |
|---|---|
| PubChem CID | 150206366 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (8R,9S,10R,13R,14S)-10,13-dimethyl-3-oxo-15-phenyl-2,6,7,8,9,11,12,14,16,17-decahydro-1H-cyclopenta[a]phenanthrene-15-carboxamide |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43C)[C@@H]1C(C(N)=O)(c1ccccc1)CC2 |
| InChI | InChI=1S/C26H33NO2/c1-24-12-11-21-20(9-8-18-16-19(28)10-13-25(18,21)2)22(24)26(15-14-24,23(27)29)17-6-4-3-5-7-17/h3-7,16,20-22H,8-15H2,1-2H3,(H2,27,29)/t20-,21+,22+,24-,25+,26?/m1/s1 |
| InChIKey | FQOMHYRCISWSGI-VNSFGZEOSA-N |
| XLogP | 4.94 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |