C8H14F3N5 — CID 150209820
4-ethyl-2-(1,1,1-trifluoropropan-2-ylimino)-1,3-dihydro-1,3,5-triazin-4-amine (PubChem CID 150209820) has the molecular formula C8H14F3N5 and a molecular weight of 237.23 g/mol. Its IUPAC name is 4-ethyl-2-(1,1,1-trifluoropropan-2-ylimino)-1,3-dihydro-1,3,5-triazin-4-amine.
| Compound Name | 4-ethyl-2-(1,1,1-trifluoropropan-2-ylimino)-1,3-dihydro-1,3,5-triazin-4-amine |
|---|---|
| PubChem CID | 150209820 |
| Molecular Formula | C8H14F3N5 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 4-ethyl-2-(1,1,1-trifluoropropan-2-ylimino)-1,3-dihydro-1,3,5-triazin-4-amine |
| SMILES | CCC1(N)N=CN/C(=N\C(C)C(F)(F)F)N1 |
| InChI | InChI=1S/C8H14F3N5/c1-3-7(12)14-4-13-6(16-7)15-5(2)8(9,10)11/h4-5H,3,12H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | FRGBOBATUVDHSW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|