C19H18F3NO5 — CID 150210672
3,6-dihydroxy-1-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 150210672) has the molecular formula C19H18F3NO5 and a molecular weight of 397.35 g/mol. Its IUPAC name is 3,6-dihydroxy-1-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 3,6-dihydroxy-1-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 150210672 |
| Molecular Formula | C19H18F3NO5 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3,6-dihydroxy-1-(5,6,7,8-tetrahydronaphthalene-1-carbonylamino)-4-(trifluoromethyl)cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)C=C(O)C(C(F)(F)F)=CC1O)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C19H18F3NO5/c20-19(21,22)13-8-15(25)18(17(27)28,9-14(13)24)23-16(26)12-7-3-5-10-4-1-2-6-11(10)12/h3,5,7-9,15,24-25H,1-2,4,6H2,(H,23,26)(H,27,28) |
| InChIKey | FRKQGBPONKHQTD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |