C16H27NO — CID 150211200
(2S,4R)-2-ethyl-6-(2-methoxyphenyl)-4-methylhexan-1-amine (PubChem CID 150211200) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (2S,4R)-2-ethyl-6-(2-methoxyphenyl)-4-methylhexan-1-amine.
| Compound Name | (2S,4R)-2-ethyl-6-(2-methoxyphenyl)-4-methylhexan-1-amine |
|---|---|
| PubChem CID | 150211200 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2S,4R)-2-ethyl-6-(2-methoxyphenyl)-4-methylhexan-1-amine |
| SMILES | CC[C@H](CN)C[C@H](C)CCc1ccccc1OC |
| InChI | InChI=1S/C16H27NO/c1-4-14(12-17)11-13(2)9-10-15-7-5-6-8-16(15)18-3/h5-8,13-14H,4,9-12,17H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | FRNGMFFCNUAVRK-KGLIPLIRSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |