C20H40N2O3 — CID 15021468
N-[(2S)-1-[[(2S)-1-hydroxyhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]octanamide (PubChem CID 15021468) has the molecular formula C20H40N2O3 and a molecular weight of 356.55 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-1-hydroxyhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]octanamide.
| Compound Name | N-[(2S)-1-[[(2S)-1-hydroxyhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]octanamide |
|---|---|
| PubChem CID | 15021468 |
| Molecular Formula | C20H40N2O3 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.30 |
| IUPAC Name | N-[(2S)-1-[[(2S)-1-hydroxyhexan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]octanamide |
| SMILES | CCCCCCCC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CO)CCCC |
| InChI | InChI=1S/C20H40N2O3/c1-5-7-9-10-11-13-19(24)22-18(14-16(3)4)20(25)21-17(15-23)12-8-6-2/h16-18,23H,5-15H2,1-4H3,(H,21,25)(H,22,24)/t17-,18-/m0/s1 |
| InChIKey | KSLPJESFLISDTC-ROUUACIJSA-N |
| XLogP | 3.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|