About 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene
2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene (PubChem CID 150218582) has the molecular formula C7H7BrF2O
and a molecular weight of 225.03 g/mol. Its IUPAC name is 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene |
| PubChem CID | 150218582 |
| Molecular Formula | C7H7BrF2O |
| Molecular Weight | 225.03 g/mol |
| Exact Mass | 223.96 |
| IUPAC Name | 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene |
| SMILES | COC1(F)C=CC(Br)=CC1F |
| InChI | InChI=1S/C7H7BrF2O/c1-11-7(10)3-2-5(8)4-6(7)9/h2-4,6H,1H3 |
| InChIKey | FSZPZJLWCONMRI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.03 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene?
The IUPAC name of 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene (CID 150218582) is 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene.
What is the SMILES notation for 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene?
The canonical SMILES for 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene is COC1(F)C=CC(Br)=CC1F.
What is the InChIKey of 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene?
The InChIKey is FSZPZJLWCONMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BrF2O/c1-11-7(10)3-2-5(8)4-6(7)9/h2-4,6H,1H3.
What are the key properties of 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene?
2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene has a molecular weight of 225.03 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5,6-difluoro-5-methoxycyclohexa-1,3-diene is sourced from PubChem (CID 150218582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).