About spiro[4.4]nonan-4-amine
spiro[4.4]nonan-4-amine (PubChem CID 15021870) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is spiro[4.4]nonan-4-amine.
Molecular Properties
| Compound Name | spiro[4.4]nonan-4-amine |
| PubChem CID | 15021870 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | spiro[4.4]nonan-4-amine |
| SMILES | NC1CCCC12CCCC2 |
| InChI | InChI=1S/C9H17N/c10-8-4-3-7-9(8)5-1-2-6-9/h8H,1-7,10H2 |
| InChIKey | OHSZGDISGPXXHR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[4.4]nonan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.4]nonan-4-amine?
The IUPAC name of spiro[4.4]nonan-4-amine (CID 15021870) is spiro[4.4]nonan-4-amine.
What is the SMILES notation for spiro[4.4]nonan-4-amine?
The canonical SMILES for spiro[4.4]nonan-4-amine is NC1CCCC12CCCC2.
What is the InChIKey of spiro[4.4]nonan-4-amine?
The InChIKey is OHSZGDISGPXXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c10-8-4-3-7-9(8)5-1-2-6-9/h8H,1-7,10H2.
What are the key properties of spiro[4.4]nonan-4-amine?
spiro[4.4]nonan-4-amine has a molecular weight of 139.24 g/mol, XLogP of 2.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.4]nonan-4-amine is sourced from PubChem (CID 15021870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).