About (2-bromophenyl)carbamic acid
(2-bromophenyl)carbamic acid (PubChem CID 15021878) has the molecular formula C7H6BrNO2
and a molecular weight of 216.03 g/mol. Its IUPAC name is (2-bromophenyl)carbamic acid.
Molecular Properties
| Compound Name | (2-bromophenyl)carbamic acid |
| PubChem CID | 15021878 |
| Molecular Formula | C7H6BrNO2 |
| Molecular Weight | 216.03 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | (2-bromophenyl)carbamic acid |
| SMILES | O=C(O)Nc1ccccc1Br |
| InChI | InChI=1S/C7H6BrNO2/c8-5-3-1-2-4-6(5)9-7(10)11/h1-4,9H,(H,10,11) |
| InChIKey | FTEZEFRVMRFCJL-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.03 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-bromophenyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)carbamic acid?
The IUPAC name of (2-bromophenyl)carbamic acid (CID 15021878) is (2-bromophenyl)carbamic acid.
What is the SMILES notation for (2-bromophenyl)carbamic acid?
The canonical SMILES for (2-bromophenyl)carbamic acid is O=C(O)Nc1ccccc1Br.
What is the InChIKey of (2-bromophenyl)carbamic acid?
The InChIKey is FTEZEFRVMRFCJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrNO2/c8-5-3-1-2-4-6(5)9-7(10)11/h1-4,9H,(H,10,11).
What are the key properties of (2-bromophenyl)carbamic acid?
(2-bromophenyl)carbamic acid has a molecular weight of 216.03 g/mol, XLogP of 2.54, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)carbamic acid is sourced from PubChem (CID 15021878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).