C7H15N2O4P — CID 150219589
(1-amino-1-cyano-3-propan-2-yloxypropyl)phosphonic acid (PubChem CID 150219589) has the molecular formula C7H15N2O4P and a molecular weight of 222.18 g/mol. Its IUPAC name is (1-amino-1-cyano-3-propan-2-yloxypropyl)phosphonic acid.
| Compound Name | (1-amino-1-cyano-3-propan-2-yloxypropyl)phosphonic acid |
|---|---|
| PubChem CID | 150219589 |
| Molecular Formula | C7H15N2O4P |
| Molecular Weight | 222.18 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1-amino-1-cyano-3-propan-2-yloxypropyl)phosphonic acid |
| SMILES | CC(C)OCCC(N)(C#N)P(=O)(O)O |
| InChI | InChI=1S/C7H15N2O4P/c1-6(2)13-4-3-7(9,5-8)14(10,11)12/h6H,3-4,9H2,1-2H3,(H2,10,11,12) |
| InChIKey | FTEQLWYUJXGZJJ-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|