C10H21ClO3S3 — CID 150223209
1-[2-chloro-3-(2-hydroxyethylsulfanyl)propyl]sulfanyl-3-(2-hydroxyethylsulfanyl)propan-2-ol (PubChem CID 150223209) has the molecular formula C10H21ClO3S3 and a molecular weight of 320.93 g/mol. Its IUPAC name is 1-[2-chloro-3-(2-hydroxyethylsulfanyl)propyl]sulfanyl-3-(2-hydroxyethylsulfanyl)propan-2-ol.
| Compound Name | 1-[2-chloro-3-(2-hydroxyethylsulfanyl)propyl]sulfanyl-3-(2-hydroxyethylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 150223209 |
| Molecular Formula | C10H21ClO3S3 |
| Molecular Weight | 320.93 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-[2-chloro-3-(2-hydroxyethylsulfanyl)propyl]sulfanyl-3-(2-hydroxyethylsulfanyl)propan-2-ol |
| SMILES | OCCSCC(O)CSCC(Cl)CSCCO |
| InChI | InChI=1S/C10H21ClO3S3/c11-9(5-15-3-1-12)6-17-8-10(14)7-16-4-2-13/h9-10,12-14H,1-8H2 |
| InChIKey | FTXPPKKIPMLYAF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.93 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|