C15H11ClF3N5O — CID 150225133
1-(2-chloro-4-pyridinyl)-3-[1-methyl-5-(trifluoromethyl)indazol-3-yl]urea (PubChem CID 150225133) has the molecular formula C15H11ClF3N5O and a molecular weight of 369.73 g/mol. Its IUPAC name is 1-(2-chloro-4-pyridinyl)-3-[1-methyl-5-(trifluoromethyl)indazol-3-yl]urea.
| Compound Name | 1-(2-chloro-4-pyridinyl)-3-[1-methyl-5-(trifluoromethyl)indazol-3-yl]urea |
|---|---|
| PubChem CID | 150225133 |
| Molecular Formula | C15H11ClF3N5O |
| Molecular Weight | 369.73 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1-(2-chloro-4-pyridinyl)-3-[1-methyl-5-(trifluoromethyl)indazol-3-yl]urea |
| SMILES | Cn1nc(NC(=O)Nc2ccnc(Cl)c2)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C15H11ClF3N5O/c1-24-11-3-2-8(15(17,18)19)6-10(11)13(23-24)22-14(25)21-9-4-5-20-12(16)7-9/h2-7H,1H3,(H2,20,21,22,23,25) |
| InChIKey | FUHKLVSZEYLPPJ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.73 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|