C18H18N4 — CID 150229412
N,N'-bis(1H-indol-2-yl)ethane-1,2-diamine (PubChem CID 150229412) has the molecular formula C18H18N4 and a molecular weight of 290.37 g/mol. Its IUPAC name is N,N'-bis(1H-indol-2-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(1H-indol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 150229412 |
| Molecular Formula | C18H18N4 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N,N'-bis(1H-indol-2-yl)ethane-1,2-diamine |
| SMILES | c1ccc2[nH]c(NCCNc3cc4ccccc4[nH]3)cc2c1 |
| InChI | InChI=1S/C18H18N4/c1-3-7-15-13(5-1)11-17(21-15)19-9-10-20-18-12-14-6-2-4-8-16(14)22-18/h1-8,11-12,19-22H,9-10H2 |
| InChIKey | FVDVVMCBLKDKLA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|