C24H36O2Si — CID 150234227
tert-butyl-[3-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]propoxy]-dimethylsilane (PubChem CID 150234227) has the molecular formula C24H36O2Si and a molecular weight of 384.64 g/mol. Its IUPAC name is tert-butyl-[3-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[3-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 150234227 |
| Molecular Formula | C24H36O2Si |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl-[3-[3,5-dimethyl-4-(2-methylphenyl)phenoxy]propoxy]-dimethylsilane |
| SMILES | Cc1ccccc1-c1c(C)cc(OCCCO[Si](C)(C)C(C)(C)C)cc1C |
| InChI | InChI=1S/C24H36O2Si/c1-18-12-9-10-13-22(18)23-19(2)16-21(17-20(23)3)25-14-11-15-26-27(7,8)24(4,5)6/h9-10,12-13,16-17H,11,14-15H2,1-8H3 |
| InChIKey | FWDMGPZHTBCMOX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|