About 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid
2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid (PubChem CID 150239418) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid.
Molecular Properties
| Compound Name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid |
| PubChem CID | 150239418 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid |
| SMILES | CC(C)(C(=O)O)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C12H20O4/c1-11(2,10(13)14)9-3-5-12(6-4-9)15-7-8-16-12/h9H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | FXEYLUXWNANEGT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid?
The IUPAC name of 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid (CID 150239418) is 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid.
What is the SMILES notation for 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid?
The canonical SMILES for 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid is CC(C)(C(=O)O)C1CCC2(CC1)OCCO2.
What is the InChIKey of 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid?
The InChIKey is FXEYLUXWNANEGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-11(2,10(13)14)9-3-5-12(6-4-9)15-7-8-16-12/h9H,3-8H2,1-2H3,(H,13,14).
What are the key properties of 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid?
2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid has a molecular weight of 228.29 g/mol, XLogP of 2.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxaspiro[4.5]decan-8-yl)-2-methylpropanoic acid is sourced from PubChem (CID 150239418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).