C15H18O5 — CID 150244234
(1S)-1-(cyclopentanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid (PubChem CID 150244234) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (1S)-1-(cyclopentanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid.
| Compound Name | (1S)-1-(cyclopentanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150244234 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (1S)-1-(cyclopentanecarbonyl)-2-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid |
| SMILES | CC1C(C(=O)O)=CC=C[C@@]1(C(=O)O)C(=O)C1CCCC1 |
| InChI | InChI=1S/C15H18O5/c1-9-11(13(17)18)7-4-8-15(9,14(19)20)12(16)10-5-2-3-6-10/h4,7-10H,2-3,5-6H2,1H3,(H,17,18)(H,19,20)/t9?,15-/m0/s1 |
| InChIKey | FYECCVANBUEIHH-POGJTHQKSA-N |
| XLogP | 2.03 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|