C35H48O4 — CID 15024571
[(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 15024571) has the molecular formula C35H48O4 and a molecular weight of 532.77 g/mol. Its IUPAC name is [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 15024571 |
| Molecular Formula | C35H48O4 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC[C@@H]1C=CC(=O)[C@@H](C2CCCC=C2C)O1 |
| InChI | InChI=1S/C35H48O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-34(37)38-29-31-27-28-33(36)35(39-31)32-25-23-22-24-30(32)2/h4-5,7-8,10-11,13-14,16-17,19-20,24,27-28,31-32,35H,3,6,9,12,15,18,21-23,25-26,29H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-/t31-,32?,35+/m0/s1 |
| InChIKey | MLPLSCQIZSHDMA-AWQJIOOISA-N |
| XLogP | 8.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|