C22H30O6 — CID 15024622
7-[(1R,2S,3R)-3-hydroxy-2-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-oxocyclopentyl]-6-oxoheptanoic acid (PubChem CID 15024622) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is 7-[(1R,2S,3R)-3-hydroxy-2-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-oxocyclopentyl]-6-oxoheptanoic acid.
| Compound Name | 7-[(1R,2S,3R)-3-hydroxy-2-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-oxocyclopentyl]-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 15024622 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 7-[(1R,2S,3R)-3-hydroxy-2-[(3S,4S)-3-hydroxy-4-methylnona-1,6-diynyl]-5-oxocyclopentyl]-6-oxoheptanoic acid |
| SMILES | CCC#CC[C@H](C)[C@H](O)C#C[C@H]1[C@H](O)CC(=O)[C@@H]1CC(=O)CCCCC(=O)O |
| InChI | InChI=1S/C22H30O6/c1-3-4-5-8-15(2)19(24)12-11-17-18(21(26)14-20(17)25)13-16(23)9-6-7-10-22(27)28/h15,17-20,24-25H,3,6-10,13-14H2,1-2H3,(H,27,28)/t15-,17+,18+,19+,20+/m0/s1 |
| InChIKey | PIHBZGCAMDDQJI-CJSSEVFESA-N |
| XLogP | 1.96 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|