C53H42N8O5 — CID 150246540
1,5-bis(4,8-dimethoxy-9H-pyrido[3,4-b]indol-1-yl)-1,5-bis(9H-pyrido[3,4-b]indol-1-yl)pentan-3-one (PubChem CID 150246540) has the molecular formula C53H42N8O5 and a molecular weight of 870.97 g/mol. Its IUPAC name is 1,5-bis(4,8-dimethoxy-9H-pyrido[3,4-b]indol-1-yl)-1,5-bis(9H-pyrido[3,4-b]indol-1-yl)pentan-3-one.
| Compound Name | 1,5-bis(4,8-dimethoxy-9H-pyrido[3,4-b]indol-1-yl)-1,5-bis(9H-pyrido[3,4-b]indol-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 150246540 |
| Molecular Formula | C53H42N8O5 |
| Molecular Weight | 870.97 g/mol |
| Exact Mass | 870.33 |
| IUPAC Name | 1,5-bis(4,8-dimethoxy-9H-pyrido[3,4-b]indol-1-yl)-1,5-bis(9H-pyrido[3,4-b]indol-1-yl)pentan-3-one |
| SMILES | COc1cccc2c1[nH]c1c(C(CC(=O)CC(c3nccc4c3[nH]c3ccccc34)c3ncc(OC)c4c3[nH]c3c(OC)cccc34)c3nccc4c3[nH]c3ccccc34)ncc(OC)c12 |
| InChI | InChI=1S/C53H42N8O5/c1-63-38-17-9-13-32-42-40(65-3)25-56-48(52(42)60-44(32)38)34(46-50-30(19-21-54-46)28-11-5-7-15-36(28)58-50)23-27(62)24-35(47-51-31(20-22-55-47)29-12-6-8-16-37(29)59-51)49-53-43(41(66-4)26-57-49)33-14-10-18-39(64-2)45(33)61-53/h5-22,25-26,34-35,58-61H,23-24H2,1-4H3 |
| InChIKey | FYQBKIFHQQNXSY-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 168.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.97 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |