C18H33F3 — CID 150247345
3,4-diethyl-5,5,6-trifluorotetradec-3-ene (PubChem CID 150247345) has the molecular formula C18H33F3 and a molecular weight of 306.46 g/mol. Its IUPAC name is 3,4-diethyl-5,5,6-trifluorotetradec-3-ene.
| Compound Name | 3,4-diethyl-5,5,6-trifluorotetradec-3-ene |
|---|---|
| PubChem CID | 150247345 |
| Molecular Formula | C18H33F3 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.25 |
| IUPAC Name | 3,4-diethyl-5,5,6-trifluorotetradec-3-ene |
| SMILES | CCCCCCCCC(F)C(F)(F)C(CC)=C(CC)CC |
| InChI | InChI=1S/C18H33F3/c1-5-9-10-11-12-13-14-17(19)18(20,21)16(8-4)15(6-2)7-3/h17H,5-14H2,1-4H3 |
| InChIKey | FYUKNTQTYMNHGH-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|