C18H22BClN4O2 — CID 150248816
4-chloro-2-[(1-methylpyrazol-3-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 150248816) has the molecular formula C18H22BClN4O2 and a molecular weight of 372.67 g/mol. Its IUPAC name is 4-chloro-2-[(1-methylpyrazol-3-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-chloro-2-[(1-methylpyrazol-3-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 150248816 |
| Molecular Formula | C18H22BClN4O2 |
| Molecular Weight | 372.67 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-chloro-2-[(1-methylpyrazol-3-yl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1ccc(Cn2cc3c(Cl)c(B4OC(C)(C)C(C)(C)O4)ccc3n2)n1 |
| InChI | InChI=1S/C18H22BClN4O2/c1-17(2)18(3,4)26-19(25-17)14-6-7-15-13(16(14)20)11-24(22-15)10-12-8-9-23(5)21-12/h6-9,11H,10H2,1-5H3 |
| InChIKey | FZCCQECZEFMMHN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|