C16H20N4O3 — CID 150249549
3-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-1,2-dihydroindazole-3-carboxylic acid (PubChem CID 150249549) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-1,2-dihydroindazole-3-carboxylic acid.
| Compound Name | 3-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-1,2-dihydroindazole-3-carboxylic acid |
|---|---|
| PubChem CID | 150249549 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-[(1S,4S)-5-ethyl-2,5-diazabicyclo[2.2.1]heptane-2-carbonyl]-1,2-dihydroindazole-3-carboxylic acid |
| SMILES | CCN1C[C@@H]2C[C@H]1CN2C(=O)C1(C(=O)O)NNc2ccccc21 |
| InChI | InChI=1S/C16H20N4O3/c1-2-19-8-11-7-10(19)9-20(11)14(21)16(15(22)23)12-5-3-4-6-13(12)17-18-16/h3-6,10-11,17-18H,2,7-9H2,1H3,(H,22,23)/t10-,11-,16?/m0/s1 |
| InChIKey | FZFZMKYTNDVYNE-LFVMAQABSA-N |
| XLogP | 0.20 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|