C11H16O2 — CID 15024971
(2R,8aR)-2-methoxy-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one (PubChem CID 15024971) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (2R,8aR)-2-methoxy-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one.
| Compound Name | (2R,8aR)-2-methoxy-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 15024971 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (2R,8aR)-2-methoxy-2,5,6,7,8,8a-hexahydro-1H-azulen-4-one |
| SMILES | CO[C@H]1C=C2C(=O)CCCC[C@@H]2C1 |
| InChI | InChI=1S/C11H16O2/c1-13-9-6-8-4-2-3-5-11(12)10(8)7-9/h7-9H,2-6H2,1H3/t8-,9-/m1/s1 |
| InChIKey | YJIGECRQXJIXMZ-RKDXNWHRSA-N |
| XLogP | 2.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |