About 2-fluoro-4,6-dimethoxy-1,3,5-triazine
2-fluoro-4,6-dimethoxy-1,3,5-triazine (PubChem CID 150249762) has the molecular formula C5H6FN3O2
and a molecular weight of 159.12 g/mol. Its IUPAC name is 2-fluoro-4,6-dimethoxy-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-fluoro-4,6-dimethoxy-1,3,5-triazine |
| PubChem CID | 150249762 |
| Molecular Formula | C5H6FN3O2 |
| Molecular Weight | 159.12 g/mol |
| Exact Mass | 159.04 |
| IUPAC Name | 2-fluoro-4,6-dimethoxy-1,3,5-triazine |
| SMILES | COc1nc(F)nc(OC)n1 |
| InChI | InChI=1S/C5H6FN3O2/c1-10-4-7-3(6)8-5(9-4)11-2/h1-2H3 |
| InChIKey | FZHBPGGWXJCTJZ-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.12 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-4,6-dimethoxy-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4,6-dimethoxy-1,3,5-triazine?
The IUPAC name of 2-fluoro-4,6-dimethoxy-1,3,5-triazine (CID 150249762) is 2-fluoro-4,6-dimethoxy-1,3,5-triazine.
What is the SMILES notation for 2-fluoro-4,6-dimethoxy-1,3,5-triazine?
The canonical SMILES for 2-fluoro-4,6-dimethoxy-1,3,5-triazine is COc1nc(F)nc(OC)n1.
What is the InChIKey of 2-fluoro-4,6-dimethoxy-1,3,5-triazine?
The InChIKey is FZHBPGGWXJCTJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN3O2/c1-10-4-7-3(6)8-5(9-4)11-2/h1-2H3.
What are the key properties of 2-fluoro-4,6-dimethoxy-1,3,5-triazine?
2-fluoro-4,6-dimethoxy-1,3,5-triazine has a molecular weight of 159.12 g/mol, XLogP of 0.03, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4,6-dimethoxy-1,3,5-triazine is sourced from PubChem (CID 150249762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).