C9H10N2O — CID 150250450
2-methyl-1-(2H-pyran-2-yl)imidazole (PubChem CID 150250450) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-methyl-1-(2H-pyran-2-yl)imidazole.
| Compound Name | 2-methyl-1-(2H-pyran-2-yl)imidazole |
|---|---|
| PubChem CID | 150250450 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 2-methyl-1-(2H-pyran-2-yl)imidazole |
| SMILES | Cc1nccn1C1C=CC=CO1 |
| InChI | InChI=1S/C9H10N2O/c1-8-10-5-6-11(8)9-4-2-3-7-12-9/h2-7,9H,1H3 |
| InChIKey | FZKUYXZEILZCDS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |