About N-(methoxymethoxy)-1,1-diphenylmethanamine
N-(methoxymethoxy)-1,1-diphenylmethanamine (PubChem CID 15025161) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(methoxymethoxy)-1,1-diphenylmethanamine.
Molecular Properties
| Compound Name | N-(methoxymethoxy)-1,1-diphenylmethanamine |
| PubChem CID | 15025161 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-(methoxymethoxy)-1,1-diphenylmethanamine |
| SMILES | COCONC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H17NO2/c1-17-12-18-16-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-16H,12H2,1H3 |
| InChIKey | RJQYPDHSGPBWBT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(methoxymethoxy)-1,1-diphenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(methoxymethoxy)-1,1-diphenylmethanamine?
The IUPAC name of N-(methoxymethoxy)-1,1-diphenylmethanamine (CID 15025161) is N-(methoxymethoxy)-1,1-diphenylmethanamine.
What is the SMILES notation for N-(methoxymethoxy)-1,1-diphenylmethanamine?
The canonical SMILES for N-(methoxymethoxy)-1,1-diphenylmethanamine is COCONC(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(methoxymethoxy)-1,1-diphenylmethanamine?
The InChIKey is RJQYPDHSGPBWBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c1-17-12-18-16-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15-16H,12H2,1H3.
What are the key properties of N-(methoxymethoxy)-1,1-diphenylmethanamine?
N-(methoxymethoxy)-1,1-diphenylmethanamine has a molecular weight of 243.31 g/mol, XLogP of 2.90, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(methoxymethoxy)-1,1-diphenylmethanamine is sourced from PubChem (CID 15025161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).