About 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide
4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 150257048) has the molecular formula C12H22N2O2S
and a molecular weight of 258.39 g/mol. Its IUPAC name is 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide |
| PubChem CID | 150257048 |
| Molecular Formula | C12H22N2O2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CCCCCCC1(S(N)(=O)=O)C=CC(N)=CC1 |
| InChI | InChI=1S/C12H22N2O2S/c1-2-3-4-5-8-12(17(14,15)16)9-6-11(13)7-10-12/h6-7,9H,2-5,8,10,13H2,1H3,(H2,14,15,16) |
| InChIKey | GATUEJGXYHZQHR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide?
The IUPAC name of 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide (CID 150257048) is 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide.
What is the SMILES notation for 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide?
The canonical SMILES for 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide is CCCCCCC1(S(N)(=O)=O)C=CC(N)=CC1.
What is the InChIKey of 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide?
The InChIKey is GATUEJGXYHZQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2S/c1-2-3-4-5-8-12(17(14,15)16)9-6-11(13)7-10-12/h6-7,9H,2-5,8,10,13H2,1H3,(H2,14,15,16).
What are the key properties of 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide?
4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide has a molecular weight of 258.39 g/mol, XLogP of 1.79, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-1-hexylcyclohexa-2,4-diene-1-sulfonamide is sourced from PubChem (CID 150257048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).